C16H21N3O2 — CID 63351753
(1,3-dimethoxy-7,8,9,10-tetrahydro-6H-cyclohepta[b]quinolin-11-yl)hydrazine (PubChem CID 63351753) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is (1,3-dimethoxy-7,8,9,10-tetrahydro-6H-cyclohepta[b]quinolin-11-yl)hydrazine.
| Compound Name | (1,3-dimethoxy-7,8,9,10-tetrahydro-6H-cyclohepta[b]quinolin-11-yl)hydrazine |
|---|---|
| PubChem CID | 63351753 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | (1,3-dimethoxy-7,8,9,10-tetrahydro-6H-cyclohepta[b]quinolin-11-yl)hydrazine |
| SMILES | COc1cc(OC)c2c(NN)c3c(nc2c1)CCCCC3 |
| InChI | InChI=1S/C16H21N3O2/c1-20-10-8-13-15(14(9-10)21-2)16(19-17)11-6-4-3-5-7-12(11)18-13/h8-9H,3-7,17H2,1-2H3,(H,18,19) |
| InChIKey | UJTNYHQTKCGJCI-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|