About Benzene, 1-chloro-4-silyl-
Benzene, 1-chloro-4-silyl- (PubChem CID 6335184) has the molecular formula C6H4ClSi
and a molecular weight of 139.64 g/mol.
Molecular Properties
| Compound Name | Benzene, 1-chloro-4-silyl- |
| PubChem CID | 6335184 |
| Molecular Formula | C6H4ClSi |
| Molecular Weight | 139.64 g/mol |
| Exact Mass | 138.98 |
| IUPAC Name | — |
| SMILES | [Si]c1ccc(Cl)cc1 |
| InChI | InChI=1S/C6H4ClSi/c7-5-1-3-6(8)4-2-5/h1-4H |
| InChIKey | IDUDYCIMDWCOOK-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.64 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze Benzene, 1-chloro-4-silyl- with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Benzene, 1-chloro-4-silyl-?
The IUPAC name of Benzene, 1-chloro-4-silyl- (CID 6335184) is not available.
What is the SMILES notation for Benzene, 1-chloro-4-silyl-?
The canonical SMILES for Benzene, 1-chloro-4-silyl- is [Si]c1ccc(Cl)cc1.
What is the InChIKey of Benzene, 1-chloro-4-silyl-?
The InChIKey is IDUDYCIMDWCOOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4ClSi/c7-5-1-3-6(8)4-2-5/h1-4H.
What are the key properties of Benzene, 1-chloro-4-silyl-?
Benzene, 1-chloro-4-silyl- has a molecular weight of 139.64 g/mol, XLogP of 1.13, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for Benzene, 1-chloro-4-silyl- is sourced from PubChem (CID 6335184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).