About Allyldichlorosilane
Allyldichlorosilane (PubChem CID 6335185) has the molecular formula C3H5Cl2Si
and a molecular weight of 140.06 g/mol.
Molecular Properties
| Compound Name | Allyldichlorosilane |
|---|
| PubChem CID | 6335185 |
|---|
| Molecular Formula | C3H5Cl2Si |
|---|
| Molecular Weight | 140.06 g/mol |
|---|
| Exact Mass | 138.95 |
|---|
| IUPAC Name | — |
|---|
| SMILES | C=CC[Si](Cl)Cl |
|---|
| InChI | InChI=1S/C3H5Cl2Si/c1-2-3-6(4)5/h2H,1,3H2 |
|---|
| InChIKey | MJVFSDBAXDCTOC-UHFFFAOYSA-N |
|---|
| XLogP | 2.14 |
|---|
| TPSA | 0.00 Ų |
|---|
| H-Bond Donors | |
|---|
| H-Bond Acceptors | |
|---|
| Rotatable Bonds | 2 |
|---|
| Heavy Atoms | 6 |
|---|
| Complexity | — |
|---|
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
|---|
| MW ≤ 500 | 140.06 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze Allyldichlorosilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Allyldichlorosilane?
The IUPAC name of Allyldichlorosilane (CID 6335185) is not available.
What is the SMILES notation for Allyldichlorosilane?
The canonical SMILES for Allyldichlorosilane is C=CC[Si](Cl)Cl.
What is the InChIKey of Allyldichlorosilane?
The InChIKey is MJVFSDBAXDCTOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H5Cl2Si/c1-2-3-6(4)5/h2H,1,3H2.
What are the key properties of Allyldichlorosilane?
Allyldichlorosilane has a molecular weight of 140.06 g/mol, XLogP of 2.14, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for Allyldichlorosilane is sourced from PubChem (CID 6335185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).