About 6-(2-Methoxyethoxy)-2,5,7,10-tetraoxa-6-silaundecane
6-(2-Methoxyethoxy)-2,5,7,10-tetraoxa-6-silaundecane (PubChem CID 6335197) has the molecular formula C9H21O6Si
and a molecular weight of 253.35 g/mol.
Molecular Properties
| Compound Name | 6-(2-Methoxyethoxy)-2,5,7,10-tetraoxa-6-silaundecane |
| PubChem CID | 6335197 |
| Molecular Formula | C9H21O6Si |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | — |
| SMILES | COCCO[Si](OCCOC)OCCOC |
| InChI | InChI=1S/C9H21O6Si/c1-10-4-7-13-16(14-8-5-11-2)15-9-6-12-3/h4-9H2,1-3H3 |
| InChIKey | BDQFIUXCCBYGAP-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 6-(2-Methoxyethoxy)-2,5,7,10-tetraoxa-6-silaundecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2-Methoxyethoxy)-2,5,7,10-tetraoxa-6-silaundecane?
The IUPAC name of 6-(2-Methoxyethoxy)-2,5,7,10-tetraoxa-6-silaundecane (CID 6335197) is not available.
What is the SMILES notation for 6-(2-Methoxyethoxy)-2,5,7,10-tetraoxa-6-silaundecane?
The canonical SMILES for 6-(2-Methoxyethoxy)-2,5,7,10-tetraoxa-6-silaundecane is COCCO[Si](OCCOC)OCCOC.
What is the InChIKey of 6-(2-Methoxyethoxy)-2,5,7,10-tetraoxa-6-silaundecane?
The InChIKey is BDQFIUXCCBYGAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H21O6Si/c1-10-4-7-13-16(14-8-5-11-2)15-9-6-12-3/h4-9H2,1-3H3.
What are the key properties of 6-(2-Methoxyethoxy)-2,5,7,10-tetraoxa-6-silaundecane?
6-(2-Methoxyethoxy)-2,5,7,10-tetraoxa-6-silaundecane has a molecular weight of 253.35 g/mol, XLogP of -0.04, 12 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2-Methoxyethoxy)-2,5,7,10-tetraoxa-6-silaundecane is sourced from PubChem (CID 6335197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).