About Silanamine, N,N-diethyl-1,1-dimethyl-
Silanamine, N,N-diethyl-1,1-dimethyl- (PubChem CID 6335300) has the molecular formula C6H16NSi
and a molecular weight of 130.29 g/mol.
Molecular Properties
| Compound Name | Silanamine, N,N-diethyl-1,1-dimethyl- |
|---|
| PubChem CID | 6335300 |
|---|
| Molecular Formula | C6H16NSi |
|---|
| Molecular Weight | 130.29 g/mol |
|---|
| Exact Mass | 130.11 |
|---|
| IUPAC Name | — |
|---|
| SMILES | CCN(CC)[Si](C)C |
|---|
| InChI | InChI=1S/C6H16NSi/c1-5-7(6-2)8(3)4/h5-6H2,1-4H3 |
|---|
| InChIKey | ADTGAVILDBXARD-UHFFFAOYSA-N |
|---|
| XLogP | 1.58 |
|---|
| TPSA | 3.24 Ų |
|---|
| H-Bond Donors | |
|---|
| H-Bond Acceptors | 1 |
|---|
| Rotatable Bonds | 3 |
|---|
| Heavy Atoms | 8 |
|---|
| Complexity | — |
|---|
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
|---|
| MW ≤ 500 | 130.29 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze Silanamine, N,N-diethyl-1,1-dimethyl- with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Silanamine, N,N-diethyl-1,1-dimethyl-?
The IUPAC name of Silanamine, N,N-diethyl-1,1-dimethyl- (CID 6335300) is not available.
What is the SMILES notation for Silanamine, N,N-diethyl-1,1-dimethyl-?
The canonical SMILES for Silanamine, N,N-diethyl-1,1-dimethyl- is CCN(CC)[Si](C)C.
What is the InChIKey of Silanamine, N,N-diethyl-1,1-dimethyl-?
The InChIKey is ADTGAVILDBXARD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H16NSi/c1-5-7(6-2)8(3)4/h5-6H2,1-4H3.
What are the key properties of Silanamine, N,N-diethyl-1,1-dimethyl-?
Silanamine, N,N-diethyl-1,1-dimethyl- has a molecular weight of 130.29 g/mol, XLogP of 1.58, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for Silanamine, N,N-diethyl-1,1-dimethyl- is sourced from PubChem (CID 6335300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).