C11H15FN2 — CID 63353175
1-cyclopropyl-2-(5-fluoro-2-pyridinyl)-N-methylethanamine (PubChem CID 63353175) has the molecular formula C11H15FN2 and a molecular weight of 194.25 g/mol. Its IUPAC name is 1-cyclopropyl-2-(5-fluoro-2-pyridinyl)-N-methylethanamine.
| Compound Name | 1-cyclopropyl-2-(5-fluoro-2-pyridinyl)-N-methylethanamine |
|---|---|
| PubChem CID | 63353175 |
| Molecular Formula | C11H15FN2 |
| Molecular Weight | 194.25 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | 1-cyclopropyl-2-(5-fluoro-2-pyridinyl)-N-methylethanamine |
| SMILES | CNC(Cc1ccc(F)cn1)C1CC1 |
| InChI | InChI=1S/C11H15FN2/c1-13-11(8-2-3-8)6-10-5-4-9(12)7-14-10/h4-5,7-8,11,13H,2-3,6H2,1H3 |
| InChIKey | JBIWBKXXGIOPDH-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.25 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |