C16H22O2Si3 — CID 6335362
Trisiloxane, 1,1,5,5-tetramethyl-3,3-diphenyl- (PubChem CID 6335362) has the molecular formula C16H22O2Si3 and a molecular weight of 330.61 g/mol.
| Compound Name | Trisiloxane, 1,1,5,5-tetramethyl-3,3-diphenyl- |
|---|---|
| PubChem CID | 6335362 |
| Molecular Formula | C16H22O2Si3 |
| Molecular Weight | 330.61 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | — |
| SMILES | C[Si](C)O[Si](O[Si](C)C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H22O2Si3/c1-19(2)17-21(18-20(3)4,15-11-7-5-8-12-15)16-13-9-6-10-14-16/h5-14H,1-4H3 |
| InChIKey | BSXVSQHDSNEHCJ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.61 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|