About Silane, tris(pentyloxy)-
Silane, tris(pentyloxy)- (PubChem CID 6335363) has the molecular formula C15H33O3Si
and a molecular weight of 289.51 g/mol.
Molecular Properties
| Compound Name | Silane, tris(pentyloxy)- |
| PubChem CID | 6335363 |
| Molecular Formula | C15H33O3Si |
| Molecular Weight | 289.51 g/mol |
| Exact Mass | 289.22 |
| IUPAC Name | — |
| SMILES | CCCCCO[Si](OCCCCC)OCCCCC |
| InChI | InChI=1S/C15H33O3Si/c1-4-7-10-13-16-19(17-14-11-8-5-2)18-15-12-9-6-3/h4-15H2,1-3H3 |
| InChIKey | SFMFSJQRKXEGAM-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.51 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze Silane, tris(pentyloxy)- with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Silane, tris(pentyloxy)-?
The IUPAC name of Silane, tris(pentyloxy)- (CID 6335363) is not available.
What is the SMILES notation for Silane, tris(pentyloxy)-?
The canonical SMILES for Silane, tris(pentyloxy)- is CCCCCO[Si](OCCCCC)OCCCCC.
What is the InChIKey of Silane, tris(pentyloxy)-?
The InChIKey is SFMFSJQRKXEGAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H33O3Si/c1-4-7-10-13-16-19(17-14-11-8-5-2)18-15-12-9-6-3/h4-15H2,1-3H3.
What are the key properties of Silane, tris(pentyloxy)-?
Silane, tris(pentyloxy)- has a molecular weight of 289.51 g/mol, XLogP of 4.59, 15 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for Silane, tris(pentyloxy)- is sourced from PubChem (CID 6335363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).