About Silane, (3-chloropropyl)dimethyl-
Silane, (3-chloropropyl)dimethyl- (PubChem CID 6335368) has the molecular formula C5H12ClSi
and a molecular weight of 135.69 g/mol.
Molecular Properties
| Compound Name | Silane, (3-chloropropyl)dimethyl- |
| PubChem CID | 6335368 |
| Molecular Formula | C5H12ClSi |
| Molecular Weight | 135.69 g/mol |
| Exact Mass | 135.04 |
| IUPAC Name | — |
| SMILES | C[Si](C)CCCCl |
| InChI | InChI=1S/C5H12ClSi/c1-7(2)5-3-4-6/h3-5H2,1-2H3 |
| InChIKey | UDIMUNKNMFGPJH-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.69 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze Silane, (3-chloropropyl)dimethyl- with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Silane, (3-chloropropyl)dimethyl-?
The IUPAC name of Silane, (3-chloropropyl)dimethyl- (CID 6335368) is not available.
What is the SMILES notation for Silane, (3-chloropropyl)dimethyl-?
The canonical SMILES for Silane, (3-chloropropyl)dimethyl- is C[Si](C)CCCCl.
What is the InChIKey of Silane, (3-chloropropyl)dimethyl-?
The InChIKey is UDIMUNKNMFGPJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12ClSi/c1-7(2)5-3-4-6/h3-5H2,1-2H3.
What are the key properties of Silane, (3-chloropropyl)dimethyl-?
Silane, (3-chloropropyl)dimethyl- has a molecular weight of 135.69 g/mol, XLogP of 2.37, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for Silane, (3-chloropropyl)dimethyl- is sourced from PubChem (CID 6335368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).