About Silane, decyldimethyl-
Silane, decyldimethyl- (PubChem CID 6335399) has the molecular formula C12H27Si
and a molecular weight of 199.43 g/mol.
Molecular Properties
| Compound Name | Silane, decyldimethyl- |
| PubChem CID | 6335399 |
| Molecular Formula | C12H27Si |
| Molecular Weight | 199.43 g/mol |
| Exact Mass | 199.19 |
| IUPAC Name | — |
| SMILES | CCCCCCCCCC[Si](C)C |
| InChI | InChI=1S/C12H27Si/c1-4-5-6-7-8-9-10-11-12-13(2)3/h4-12H2,1-3H3 |
| InChIKey | AHQMQQYLFHXPOE-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.43 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze Silane, decyldimethyl- with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Silane, decyldimethyl-?
The IUPAC name of Silane, decyldimethyl- (CID 6335399) is not available.
What is the SMILES notation for Silane, decyldimethyl-?
The canonical SMILES for Silane, decyldimethyl- is CCCCCCCCCC[Si](C)C.
What is the InChIKey of Silane, decyldimethyl-?
The InChIKey is AHQMQQYLFHXPOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H27Si/c1-4-5-6-7-8-9-10-11-12-13(2)3/h4-12H2,1-3H3.
What are the key properties of Silane, decyldimethyl-?
Silane, decyldimethyl- has a molecular weight of 199.43 g/mol, XLogP of 4.88, 9 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for Silane, decyldimethyl- is sourced from PubChem (CID 6335399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).