About 6-cyclopropyl-2-(2,4-dimethylphenyl)-N-ethylpyrimidin-4-amine
6-cyclopropyl-2-(2,4-dimethylphenyl)-N-ethylpyrimidin-4-amine (PubChem CID 63354598) has the molecular formula C17H21N3
and a molecular weight of 267.38 g/mol. Its IUPAC name is 6-cyclopropyl-2-(2,4-dimethylphenyl)-N-ethylpyrimidin-4-amine.
Molecular Properties
| Compound Name | 6-cyclopropyl-2-(2,4-dimethylphenyl)-N-ethylpyrimidin-4-amine |
| PubChem CID | 63354598 |
| Molecular Formula | C17H21N3 |
| Molecular Weight | 267.38 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | 6-cyclopropyl-2-(2,4-dimethylphenyl)-N-ethylpyrimidin-4-amine |
| SMILES | CCNc1cc(C2CC2)nc(-c2ccc(C)cc2C)n1 |
| InChI | InChI=1S/C17H21N3/c1-4-18-16-10-15(13-6-7-13)19-17(20-16)14-8-5-11(2)9-12(14)3/h5,8-10,13H,4,6-7H2,1-3H3,(H,18,19,20) |
| InChIKey | BHCHQHCBCHVQLO-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.38 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-cyclopropyl-2-(2,4-dimethylphenyl)-N-ethylpyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-cyclopropyl-2-(2,4-dimethylphenyl)-N-ethylpyrimidin-4-amine?
The IUPAC name of 6-cyclopropyl-2-(2,4-dimethylphenyl)-N-ethylpyrimidin-4-amine (CID 63354598) is 6-cyclopropyl-2-(2,4-dimethylphenyl)-N-ethylpyrimidin-4-amine.
What is the SMILES notation for 6-cyclopropyl-2-(2,4-dimethylphenyl)-N-ethylpyrimidin-4-amine?
The canonical SMILES for 6-cyclopropyl-2-(2,4-dimethylphenyl)-N-ethylpyrimidin-4-amine is CCNc1cc(C2CC2)nc(-c2ccc(C)cc2C)n1.
What is the InChIKey of 6-cyclopropyl-2-(2,4-dimethylphenyl)-N-ethylpyrimidin-4-amine?
The InChIKey is BHCHQHCBCHVQLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21N3/c1-4-18-16-10-15(13-6-7-13)19-17(20-16)14-8-5-11(2)9-12(14)3/h5,8-10,13H,4,6-7H2,1-3H3,(H,18,19,20).
What are the key properties of 6-cyclopropyl-2-(2,4-dimethylphenyl)-N-ethylpyrimidin-4-amine?
6-cyclopropyl-2-(2,4-dimethylphenyl)-N-ethylpyrimidin-4-amine has a molecular weight of 267.38 g/mol, XLogP of 4.07, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-cyclopropyl-2-(2,4-dimethylphenyl)-N-ethylpyrimidin-4-amine is sourced from PubChem (CID 63354598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).