C13H18ClN — CID 63355001
3-(3-chlorophenyl)-1-cyclopropyl-N-methylpropan-1-amine (PubChem CID 63355001) has the molecular formula C13H18ClN and a molecular weight of 223.75 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-1-cyclopropyl-N-methylpropan-1-amine.
| Compound Name | 3-(3-chlorophenyl)-1-cyclopropyl-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 63355001 |
| Molecular Formula | C13H18ClN |
| Molecular Weight | 223.75 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | 3-(3-chlorophenyl)-1-cyclopropyl-N-methylpropan-1-amine |
| SMILES | CNC(CCc1cccc(Cl)c1)C1CC1 |
| InChI | InChI=1S/C13H18ClN/c1-15-13(11-6-7-11)8-5-10-3-2-4-12(14)9-10/h2-4,9,11,13,15H,5-8H2,1H3 |
| InChIKey | SWROQHSXAUWLGW-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.75 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |