About ethyl 2,5-dimethyl-1,2,4-triazole-3-carboxylate
ethyl 2,5-dimethyl-1,2,4-triazole-3-carboxylate (PubChem CID 63356234) has the molecular formula C7H11N3O2
and a molecular weight of 169.18 g/mol. Its IUPAC name is ethyl 2,5-dimethyl-1,2,4-triazole-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 2,5-dimethyl-1,2,4-triazole-3-carboxylate |
| PubChem CID | 63356234 |
| Molecular Formula | C7H11N3O2 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | ethyl 2,5-dimethyl-1,2,4-triazole-3-carboxylate |
| SMILES | CCOC(=O)c1nc(C)nn1C |
| InChI | InChI=1S/C7H11N3O2/c1-4-12-7(11)6-8-5(2)9-10(6)3/h4H2,1-3H3 |
| InChIKey | VCYYMPFMOTUVNW-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 2,5-dimethyl-1,2,4-triazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2,5-dimethyl-1,2,4-triazole-3-carboxylate?
The IUPAC name of ethyl 2,5-dimethyl-1,2,4-triazole-3-carboxylate (CID 63356234) is ethyl 2,5-dimethyl-1,2,4-triazole-3-carboxylate.
What is the SMILES notation for ethyl 2,5-dimethyl-1,2,4-triazole-3-carboxylate?
The canonical SMILES for ethyl 2,5-dimethyl-1,2,4-triazole-3-carboxylate is CCOC(=O)c1nc(C)nn1C.
What is the InChIKey of ethyl 2,5-dimethyl-1,2,4-triazole-3-carboxylate?
The InChIKey is VCYYMPFMOTUVNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3O2/c1-4-12-7(11)6-8-5(2)9-10(6)3/h4H2,1-3H3.
What are the key properties of ethyl 2,5-dimethyl-1,2,4-triazole-3-carboxylate?
ethyl 2,5-dimethyl-1,2,4-triazole-3-carboxylate has a molecular weight of 169.18 g/mol, XLogP of 0.30, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2,5-dimethyl-1,2,4-triazole-3-carboxylate is sourced from PubChem (CID 63356234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).