About 4-amino-3-(1,2,4-triazol-1-yl)benzamide
4-amino-3-(1,2,4-triazol-1-yl)benzamide (PubChem CID 63356286) has the molecular formula C9H9N5O
and a molecular weight of 203.21 g/mol. Its IUPAC name is 4-amino-3-(1,2,4-triazol-1-yl)benzamide.
Molecular Properties
| Compound Name | 4-amino-3-(1,2,4-triazol-1-yl)benzamide |
| PubChem CID | 63356286 |
| Molecular Formula | C9H9N5O |
| Molecular Weight | 203.21 g/mol |
| Exact Mass | 203.08 |
| IUPAC Name | 4-amino-3-(1,2,4-triazol-1-yl)benzamide |
| SMILES | NC(=O)c1ccc(N)c(-n2cncn2)c1 |
| InChI | InChI=1S/C9H9N5O/c10-7-2-1-6(9(11)15)3-8(7)14-5-12-4-13-14/h1-5H,10H2,(H2,11,15) |
| InChIKey | GYXCLLHENQITEP-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 99.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.21 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-3-(1,2,4-triazol-1-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-3-(1,2,4-triazol-1-yl)benzamide?
The IUPAC name of 4-amino-3-(1,2,4-triazol-1-yl)benzamide (CID 63356286) is 4-amino-3-(1,2,4-triazol-1-yl)benzamide.
What is the SMILES notation for 4-amino-3-(1,2,4-triazol-1-yl)benzamide?
The canonical SMILES for 4-amino-3-(1,2,4-triazol-1-yl)benzamide is NC(=O)c1ccc(N)c(-n2cncn2)c1.
What is the InChIKey of 4-amino-3-(1,2,4-triazol-1-yl)benzamide?
The InChIKey is GYXCLLHENQITEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N5O/c10-7-2-1-6(9(11)15)3-8(7)14-5-12-4-13-14/h1-5H,10H2,(H2,11,15).
What are the key properties of 4-amino-3-(1,2,4-triazol-1-yl)benzamide?
4-amino-3-(1,2,4-triazol-1-yl)benzamide has a molecular weight of 203.21 g/mol, XLogP of -0.05, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-3-(1,2,4-triazol-1-yl)benzamide is sourced from PubChem (CID 63356286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).