About 4-amino-3-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)benzamide
4-amino-3-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)benzamide (PubChem CID 63356618) has the molecular formula C16H17N3O2
and a molecular weight of 283.33 g/mol. Its IUPAC name is 4-amino-3-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)benzamide.
Molecular Properties
| Compound Name | 4-amino-3-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)benzamide |
| PubChem CID | 63356618 |
| Molecular Formula | C16H17N3O2 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | 4-amino-3-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)benzamide |
| SMILES | NC(=O)c1ccc(N)c(N2CCOc3ccccc3C2)c1 |
| InChI | InChI=1S/C16H17N3O2/c17-13-6-5-11(16(18)20)9-14(13)19-7-8-21-15-4-2-1-3-12(15)10-19/h1-6,9H,7-8,10,17H2,(H2,18,20) |
| InChIKey | VTOHQUQFYYRZJA-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 81.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-3-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-3-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)benzamide?
The IUPAC name of 4-amino-3-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)benzamide (CID 63356618) is 4-amino-3-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)benzamide.
What is the SMILES notation for 4-amino-3-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)benzamide?
The canonical SMILES for 4-amino-3-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)benzamide is NC(=O)c1ccc(N)c(N2CCOc3ccccc3C2)c1.
What is the InChIKey of 4-amino-3-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)benzamide?
The InChIKey is VTOHQUQFYYRZJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17N3O2/c17-13-6-5-11(16(18)20)9-14(13)19-7-8-21-15-4-2-1-3-12(15)10-19/h1-6,9H,7-8,10,17H2,(H2,18,20).
What are the key properties of 4-amino-3-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)benzamide?
4-amino-3-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)benzamide has a molecular weight of 283.33 g/mol, XLogP of 1.77, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-3-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)benzamide is sourced from PubChem (CID 63356618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).