C28H29N2O3S2Se+ — CID 6335672
2-[(2E)-2-[(Z)-3-(3-ethyl-5-methoxy-1,3-benzoselenazol-3-ium-2-yl)-2-thiophen-2-ylprop-2-enylidene]-6-methoxy-5-methyl-1,3-benzothiazol-3-yl]ethanol (PubChem CID 6335672) has the molecular formula C28H29N2O3S2Se+ and a molecular weight of 584.65 g/mol. Its IUPAC name is 2-[(2E)-2-[(Z)-3-(3-ethyl-5-methoxy-1,3-benzoselenazol-3-ium-2-yl)-2-thiophen-2-ylprop-2-enylidene]-6-methoxy-5-methyl-1,3-benzothiazol-3-yl]ethanol.
| Compound Name | 2-[(2E)-2-[(Z)-3-(3-ethyl-5-methoxy-1,3-benzoselenazol-3-ium-2-yl)-2-thiophen-2-ylprop-2-enylidene]-6-methoxy-5-methyl-1,3-benzothiazol-3-yl]ethanol |
|---|---|
| PubChem CID | 6335672 |
| Molecular Formula | C28H29N2O3S2Se+ |
| Molecular Weight | 584.65 g/mol |
| Exact Mass | 585.08 |
| IUPAC Name | 2-[(2E)-2-[(Z)-3-(3-ethyl-5-methoxy-1,3-benzoselenazol-3-ium-2-yl)-2-thiophen-2-ylprop-2-enylidene]-6-methoxy-5-methyl-1,3-benzothiazol-3-yl]ethanol |
| SMILES | CC[n+]1c(/C=C(/C=C2/Sc3cc(OC)c(C)cc3N2CCO)c2cccs2)[se]c2ccc(OC)cc21 |
| InChI | InChI=1S/C28H29N2O3S2Se/c1-5-29-22-16-20(32-3)8-9-26(22)36-28(29)15-19(24-7-6-12-34-24)14-27-30(10-11-31)21-13-18(2)23(33-4)17-25(21)35-27/h6-9,12-17,31H,5,10-11H2,1-4H3/q+1 |
| InChIKey | HSIZJGVEFPWWNM-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 45.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.65 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|