About Cyclohexene, 4-(2-(dichlorosilyl)ethyl)-
Cyclohexene, 4-(2-(dichlorosilyl)ethyl)- (PubChem CID 6335717) has the molecular formula C8H13Cl2Si
and a molecular weight of 208.18 g/mol.
Molecular Properties
| Compound Name | Cyclohexene, 4-(2-(dichlorosilyl)ethyl)- |
| PubChem CID | 6335717 |
| Molecular Formula | C8H13Cl2Si |
| Molecular Weight | 208.18 g/mol |
| Exact Mass | 207.02 |
| IUPAC Name | — |
| SMILES | Cl[Si](Cl)CCC1CC=CCC1 |
| InChI | InChI=1S/C8H13Cl2Si/c9-11(10)7-6-8-4-2-1-3-5-8/h1-2,8H,3-7H2 |
| InChIKey | VXFGFQZMJBABNN-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.18 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze Cyclohexene, 4-(2-(dichlorosilyl)ethyl)- with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Cyclohexene, 4-(2-(dichlorosilyl)ethyl)-?
The IUPAC name of Cyclohexene, 4-(2-(dichlorosilyl)ethyl)- (CID 6335717) is not available.
What is the SMILES notation for Cyclohexene, 4-(2-(dichlorosilyl)ethyl)-?
The canonical SMILES for Cyclohexene, 4-(2-(dichlorosilyl)ethyl)- is Cl[Si](Cl)CCC1CC=CCC1.
What is the InChIKey of Cyclohexene, 4-(2-(dichlorosilyl)ethyl)-?
The InChIKey is VXFGFQZMJBABNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13Cl2Si/c9-11(10)7-6-8-4-2-1-3-5-8/h1-2,8H,3-7H2.
What are the key properties of Cyclohexene, 4-(2-(dichlorosilyl)ethyl)-?
Cyclohexene, 4-(2-(dichlorosilyl)ethyl)- has a molecular weight of 208.18 g/mol, XLogP of 3.70, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for Cyclohexene, 4-(2-(dichlorosilyl)ethyl)- is sourced from PubChem (CID 6335717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).