About 2-cyclopropyl-6-(2,2,2-trifluoroethoxy)-1H-quinolin-4-one
2-cyclopropyl-6-(2,2,2-trifluoroethoxy)-1H-quinolin-4-one (PubChem CID 63357998) has the molecular formula C14H12F3NO2
and a molecular weight of 283.25 g/mol. Its IUPAC name is 2-cyclopropyl-6-(2,2,2-trifluoroethoxy)-1H-quinolin-4-one.
Molecular Properties
| Compound Name | 2-cyclopropyl-6-(2,2,2-trifluoroethoxy)-1H-quinolin-4-one |
| PubChem CID | 63357998 |
| Molecular Formula | C14H12F3NO2 |
| Molecular Weight | 283.25 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | 2-cyclopropyl-6-(2,2,2-trifluoroethoxy)-1H-quinolin-4-one |
| SMILES | O=c1cc(C2CC2)[nH]c2ccc(OCC(F)(F)F)cc12 |
| InChI | InChI=1S/C14H12F3NO2/c15-14(16,17)7-20-9-3-4-11-10(5-9)13(19)6-12(18-11)8-1-2-8/h3-6,8H,1-2,7H2,(H,18,19) |
| InChIKey | GRSOXZBHBTZOOW-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.25 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-cyclopropyl-6-(2,2,2-trifluoroethoxy)-1H-quinolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropyl-6-(2,2,2-trifluoroethoxy)-1H-quinolin-4-one?
The IUPAC name of 2-cyclopropyl-6-(2,2,2-trifluoroethoxy)-1H-quinolin-4-one (CID 63357998) is 2-cyclopropyl-6-(2,2,2-trifluoroethoxy)-1H-quinolin-4-one.
What is the SMILES notation for 2-cyclopropyl-6-(2,2,2-trifluoroethoxy)-1H-quinolin-4-one?
The canonical SMILES for 2-cyclopropyl-6-(2,2,2-trifluoroethoxy)-1H-quinolin-4-one is O=c1cc(C2CC2)[nH]c2ccc(OCC(F)(F)F)cc12.
What is the InChIKey of 2-cyclopropyl-6-(2,2,2-trifluoroethoxy)-1H-quinolin-4-one?
The InChIKey is GRSOXZBHBTZOOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12F3NO2/c15-14(16,17)7-20-9-3-4-11-10(5-9)13(19)6-12(18-11)8-1-2-8/h3-6,8H,1-2,7H2,(H,18,19).
What are the key properties of 2-cyclopropyl-6-(2,2,2-trifluoroethoxy)-1H-quinolin-4-one?
2-cyclopropyl-6-(2,2,2-trifluoroethoxy)-1H-quinolin-4-one has a molecular weight of 283.25 g/mol, XLogP of 3.35, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropyl-6-(2,2,2-trifluoroethoxy)-1H-quinolin-4-one is sourced from PubChem (CID 63357998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).