C16H20N2 — CID 63358059
2-cyclopropyl-8-methyl-N-propylquinolin-4-amine (PubChem CID 63358059) has the molecular formula C16H20N2 and a molecular weight of 240.35 g/mol. Its IUPAC name is 2-cyclopropyl-8-methyl-N-propylquinolin-4-amine.
| Compound Name | 2-cyclopropyl-8-methyl-N-propylquinolin-4-amine |
|---|---|
| PubChem CID | 63358059 |
| Molecular Formula | C16H20N2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | 2-cyclopropyl-8-methyl-N-propylquinolin-4-amine |
| SMILES | CCCNc1cc(C2CC2)nc2c(C)cccc12 |
| InChI | InChI=1S/C16H20N2/c1-3-9-17-15-10-14(12-7-8-12)18-16-11(2)5-4-6-13(15)16/h4-6,10,12H,3,7-9H2,1-2H3,(H,17,18) |
| InChIKey | KEVVTDIHWGWABP-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |