About (2-cyclopropyl-7,8-dimethylquinolin-4-yl)hydrazine
(2-cyclopropyl-7,8-dimethylquinolin-4-yl)hydrazine (PubChem CID 63358299) has the molecular formula C14H17N3
and a molecular weight of 227.31 g/mol. Its IUPAC name is (2-cyclopropyl-7,8-dimethylquinolin-4-yl)hydrazine.
Molecular Properties
| Compound Name | (2-cyclopropyl-7,8-dimethylquinolin-4-yl)hydrazine |
| PubChem CID | 63358299 |
| Molecular Formula | C14H17N3 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.14 |
| IUPAC Name | (2-cyclopropyl-7,8-dimethylquinolin-4-yl)hydrazine |
| SMILES | Cc1ccc2c(NN)cc(C3CC3)nc2c1C |
| InChI | InChI=1S/C14H17N3/c1-8-3-6-11-13(17-15)7-12(10-4-5-10)16-14(11)9(8)2/h3,6-7,10H,4-5,15H2,1-2H3,(H,16,17) |
| InChIKey | WWRMYHMVQOLUPM-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2-cyclopropyl-7,8-dimethylquinolin-4-yl)hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-cyclopropyl-7,8-dimethylquinolin-4-yl)hydrazine?
The IUPAC name of (2-cyclopropyl-7,8-dimethylquinolin-4-yl)hydrazine (CID 63358299) is (2-cyclopropyl-7,8-dimethylquinolin-4-yl)hydrazine.
What is the SMILES notation for (2-cyclopropyl-7,8-dimethylquinolin-4-yl)hydrazine?
The canonical SMILES for (2-cyclopropyl-7,8-dimethylquinolin-4-yl)hydrazine is Cc1ccc2c(NN)cc(C3CC3)nc2c1C.
What is the InChIKey of (2-cyclopropyl-7,8-dimethylquinolin-4-yl)hydrazine?
The InChIKey is WWRMYHMVQOLUPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N3/c1-8-3-6-11-13(17-15)7-12(10-4-5-10)16-14(11)9(8)2/h3,6-7,10H,4-5,15H2,1-2H3,(H,16,17).
What are the key properties of (2-cyclopropyl-7,8-dimethylquinolin-4-yl)hydrazine?
(2-cyclopropyl-7,8-dimethylquinolin-4-yl)hydrazine has a molecular weight of 227.31 g/mol, XLogP of 3.01, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-cyclopropyl-7,8-dimethylquinolin-4-yl)hydrazine is sourced from PubChem (CID 63358299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).