About 4-Bromo-2,5-dichlorophenol sodium salt
4-Bromo-2,5-dichlorophenol sodium salt (PubChem CID 6335915) has the molecular formula C6H3BrCl2NaO
and a molecular weight of 264.89 g/mol.
Molecular Properties
| Compound Name | 4-Bromo-2,5-dichlorophenol sodium salt |
| PubChem CID | 6335915 |
| Molecular Formula | C6H3BrCl2NaO |
| Molecular Weight | 264.89 g/mol |
| Exact Mass | 262.86 |
| IUPAC Name | — |
| SMILES | Oc1cc(Cl)c(Br)cc1Cl.[Na] |
| InChI | InChI=1S/C6H3BrCl2O.Na/c7-3-1-5(9)6(10)2-4(3)8;/h1-2,10H; |
| InChIKey | FYRVMZSKWATEMP-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.89 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 4-Bromo-2,5-dichlorophenol sodium salt with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-Bromo-2,5-dichlorophenol sodium salt?
The IUPAC name of 4-Bromo-2,5-dichlorophenol sodium salt (CID 6335915) is not available.
What is the SMILES notation for 4-Bromo-2,5-dichlorophenol sodium salt?
The canonical SMILES for 4-Bromo-2,5-dichlorophenol sodium salt is Oc1cc(Cl)c(Br)cc1Cl.[Na].
What is the InChIKey of 4-Bromo-2,5-dichlorophenol sodium salt?
The InChIKey is FYRVMZSKWATEMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3BrCl2O.Na/c7-3-1-5(9)6(10)2-4(3)8;/h1-2,10H;.
What are the key properties of 4-Bromo-2,5-dichlorophenol sodium salt?
4-Bromo-2,5-dichlorophenol sodium salt has a molecular weight of 264.89 g/mol, XLogP of 3.08, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-Bromo-2,5-dichlorophenol sodium salt is sourced from PubChem (CID 6335915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).