C12H9FN4O — CID 63359657
N-[(4-cyano-2-fluorophenyl)methyl]-1H-pyrazole-4-carboxamide (PubChem CID 63359657) has the molecular formula C12H9FN4O and a molecular weight of 244.23 g/mol. Its IUPAC name is N-[(4-cyano-2-fluorophenyl)methyl]-1H-pyrazole-4-carboxamide.
| Compound Name | N-[(4-cyano-2-fluorophenyl)methyl]-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 63359657 |
| Molecular Formula | C12H9FN4O |
| Molecular Weight | 244.23 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | N-[(4-cyano-2-fluorophenyl)methyl]-1H-pyrazole-4-carboxamide |
| SMILES | N#Cc1ccc(CNC(=O)c2cn[nH]c2)c(F)c1 |
| InChI | InChI=1S/C12H9FN4O/c13-11-3-8(4-14)1-2-9(11)5-15-12(18)10-6-16-17-7-10/h1-3,6-7H,5H2,(H,15,18)(H,16,17) |
| InChIKey | CRMUTSKUNHISSY-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 81.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.23 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |