C11H14Cl2N2O3S — CID 63359825
2-amino-4,6-dichloro-N-(oxan-3-yl)benzenesulfonamide (PubChem CID 63359825) has the molecular formula C11H14Cl2N2O3S and a molecular weight of 325.22 g/mol. Its IUPAC name is 2-amino-4,6-dichloro-N-(oxan-3-yl)benzenesulfonamide.
| Compound Name | 2-amino-4,6-dichloro-N-(oxan-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 63359825 |
| Molecular Formula | C11H14Cl2N2O3S |
| Molecular Weight | 325.22 g/mol |
| Exact Mass | 324.01 |
| IUPAC Name | 2-amino-4,6-dichloro-N-(oxan-3-yl)benzenesulfonamide |
| SMILES | Nc1cc(Cl)cc(Cl)c1S(=O)(=O)NC1CCCOC1 |
| InChI | InChI=1S/C11H14Cl2N2O3S/c12-7-4-9(13)11(10(14)5-7)19(16,17)15-8-2-1-3-18-6-8/h4-5,8,15H,1-3,6,14H2 |
| InChIKey | HVBPGUNONYEFIM-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.22 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|