About 3-methyl-1-(oxan-3-yl)-1,5-diazocane
3-methyl-1-(oxan-3-yl)-1,5-diazocane (PubChem CID 63361265) has the molecular formula C12H24N2O
and a molecular weight of 212.34 g/mol. Its IUPAC name is 3-methyl-1-(oxan-3-yl)-1,5-diazocane.
Molecular Properties
| Compound Name | 3-methyl-1-(oxan-3-yl)-1,5-diazocane |
| PubChem CID | 63361265 |
| Molecular Formula | C12H24N2O |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.19 |
| IUPAC Name | 3-methyl-1-(oxan-3-yl)-1,5-diazocane |
| SMILES | CC1CNCCCN(C2CCCOC2)C1 |
| InChI | InChI=1S/C12H24N2O/c1-11-8-13-5-3-6-14(9-11)12-4-2-7-15-10-12/h11-13H,2-10H2,1H3 |
| InChIKey | JMKDZEOCJWNTLW-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-methyl-1-(oxan-3-yl)-1,5-diazocane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-1-(oxan-3-yl)-1,5-diazocane?
The IUPAC name of 3-methyl-1-(oxan-3-yl)-1,5-diazocane (CID 63361265) is 3-methyl-1-(oxan-3-yl)-1,5-diazocane.
What is the SMILES notation for 3-methyl-1-(oxan-3-yl)-1,5-diazocane?
The canonical SMILES for 3-methyl-1-(oxan-3-yl)-1,5-diazocane is CC1CNCCCN(C2CCCOC2)C1.
What is the InChIKey of 3-methyl-1-(oxan-3-yl)-1,5-diazocane?
The InChIKey is JMKDZEOCJWNTLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2O/c1-11-8-13-5-3-6-14(9-11)12-4-2-7-15-10-12/h11-13H,2-10H2,1H3.
What are the key properties of 3-methyl-1-(oxan-3-yl)-1,5-diazocane?
3-methyl-1-(oxan-3-yl)-1,5-diazocane has a molecular weight of 212.34 g/mol, XLogP of 1.10, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-1-(oxan-3-yl)-1,5-diazocane is sourced from PubChem (CID 63361265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).