C12H24N2O — CID 63361265
3-methyl-1-(oxan-3-yl)-1,5-diazocane (PubChem CID 63361265) has the molecular formula C12H24N2O and a molecular weight of 212.34 g/mol. Its IUPAC name is 3-methyl-1-(oxan-3-yl)-1,5-diazocane.
| Compound Name | 3-methyl-1-(oxan-3-yl)-1,5-diazocane |
|---|---|
| PubChem CID | 63361265 |
| Molecular Formula | C12H24N2O |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.19 |
| IUPAC Name | 3-methyl-1-(oxan-3-yl)-1,5-diazocane |
| SMILES | CC1CNCCCN(C2CCCOC2)C1 |
| InChI | InChI=1S/C12H24N2O/c1-11-8-13-5-3-6-14(9-11)12-4-2-7-15-10-12/h11-13H,2-10H2,1H3 |
| InChIKey | JMKDZEOCJWNTLW-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |