About 1-tert-butyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]guanidine
1-tert-butyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]guanidine (PubChem CID 63363235) has the molecular formula C9H18F3N3O
and a molecular weight of 241.26 g/mol. Its IUPAC name is 1-tert-butyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]guanidine.
Molecular Properties
| Compound Name | 1-tert-butyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]guanidine |
| PubChem CID | 63363235 |
| Molecular Formula | C9H18F3N3O |
| Molecular Weight | 241.26 g/mol |
| Exact Mass | 241.14 |
| IUPAC Name | 1-tert-butyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]guanidine |
| SMILES | CC(C)(C)N/C(N)=N/CCOCC(F)(F)F |
| InChI | InChI=1S/C9H18F3N3O/c1-8(2,3)15-7(13)14-4-5-16-6-9(10,11)12/h4-6H2,1-3H3,(H3,13,14,15) |
| InChIKey | YICJNTJVMGJBEB-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.26 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-tert-butyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]guanidine?
The IUPAC name of 1-tert-butyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]guanidine (CID 63363235) is 1-tert-butyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]guanidine.
What is the SMILES notation for 1-tert-butyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]guanidine?
The canonical SMILES for 1-tert-butyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]guanidine is CC(C)(C)N/C(N)=N/CCOCC(F)(F)F.
What is the InChIKey of 1-tert-butyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]guanidine?
The InChIKey is YICJNTJVMGJBEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18F3N3O/c1-8(2,3)15-7(13)14-4-5-16-6-9(10,11)12/h4-6H2,1-3H3,(H3,13,14,15).
What are the key properties of 1-tert-butyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]guanidine?
1-tert-butyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]guanidine has a molecular weight of 241.26 g/mol, XLogP of 1.27, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]guanidine is sourced from PubChem (CID 63363235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).