About (1R)-1-(2-methyl-1,3-thiazol-4-yl)ethanol
(1R)-1-(2-methyl-1,3-thiazol-4-yl)ethanol (PubChem CID 63365053) has the molecular formula C6H9NOS
and a molecular weight of 143.21 g/mol. Its IUPAC name is (1R)-1-(2-methyl-1,3-thiazol-4-yl)ethanol.
Molecular Properties
| Compound Name | (1R)-1-(2-methyl-1,3-thiazol-4-yl)ethanol |
| PubChem CID | 63365053 |
| Molecular Formula | C6H9NOS |
| Molecular Weight | 143.21 g/mol |
| Exact Mass | 143.04 |
| IUPAC Name | (1R)-1-(2-methyl-1,3-thiazol-4-yl)ethanol |
| SMILES | Cc1nc([C@@H](C)O)cs1 |
| InChI | InChI=1S/C6H9NOS/c1-4(8)6-3-9-5(2)7-6/h3-4,8H,1-2H3/t4-/m1/s1 |
| InChIKey | ACSHMDVBFQODIU-SCSAIBSYSA-N |
| XLogP | 1.50 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.21 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1R)-1-(2-methyl-1,3-thiazol-4-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-1-(2-methyl-1,3-thiazol-4-yl)ethanol?
The IUPAC name of (1R)-1-(2-methyl-1,3-thiazol-4-yl)ethanol (CID 63365053) is (1R)-1-(2-methyl-1,3-thiazol-4-yl)ethanol.
What is the SMILES notation for (1R)-1-(2-methyl-1,3-thiazol-4-yl)ethanol?
The canonical SMILES for (1R)-1-(2-methyl-1,3-thiazol-4-yl)ethanol is Cc1nc([C@@H](C)O)cs1.
What is the InChIKey of (1R)-1-(2-methyl-1,3-thiazol-4-yl)ethanol?
The InChIKey is ACSHMDVBFQODIU-SCSAIBSYSA-N. The full InChI is InChI=1S/C6H9NOS/c1-4(8)6-3-9-5(2)7-6/h3-4,8H,1-2H3/t4-/m1/s1.
What are the key properties of (1R)-1-(2-methyl-1,3-thiazol-4-yl)ethanol?
(1R)-1-(2-methyl-1,3-thiazol-4-yl)ethanol has a molecular weight of 143.21 g/mol, XLogP of 1.50, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-1-(2-methyl-1,3-thiazol-4-yl)ethanol is sourced from PubChem (CID 63365053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).