C14H19FO3 — CID 63365868
(1R)-1-[4-fluoro-2-(oxan-2-ylmethoxy)phenyl]ethanol (PubChem CID 63365868) has the molecular formula C14H19FO3 and a molecular weight of 254.30 g/mol. Its IUPAC name is (1R)-1-[4-fluoro-2-(oxan-2-ylmethoxy)phenyl]ethanol.
| Compound Name | (1R)-1-[4-fluoro-2-(oxan-2-ylmethoxy)phenyl]ethanol |
|---|---|
| PubChem CID | 63365868 |
| Molecular Formula | C14H19FO3 |
| Molecular Weight | 254.30 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | (1R)-1-[4-fluoro-2-(oxan-2-ylmethoxy)phenyl]ethanol |
| SMILES | C[C@@H](O)c1ccc(F)cc1OCC1CCCCO1 |
| InChI | InChI=1S/C14H19FO3/c1-10(16)13-6-5-11(15)8-14(13)18-9-12-4-2-3-7-17-12/h5-6,8,10,12,16H,2-4,7,9H2,1H3/t10-,12?/m1/s1 |
| InChIKey | BLBRGEUGUNECLN-RWANSRKNSA-N |
| XLogP | 2.83 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.30 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |