C16H17N3O — CID 63367788
3-[[4-[(1S)-1-aminopropyl]phenoxy]methyl]pyridine-2-carbonitrile (PubChem CID 63367788) has the molecular formula C16H17N3O and a molecular weight of 267.33 g/mol. Its IUPAC name is 3-[[4-[(1S)-1-aminopropyl]phenoxy]methyl]pyridine-2-carbonitrile.
| Compound Name | 3-[[4-[(1S)-1-aminopropyl]phenoxy]methyl]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 63367788 |
| Molecular Formula | C16H17N3O |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | 3-[[4-[(1S)-1-aminopropyl]phenoxy]methyl]pyridine-2-carbonitrile |
| SMILES | CC[C@H](N)c1ccc(OCc2cccnc2C#N)cc1 |
| InChI | InChI=1S/C16H17N3O/c1-2-15(18)12-5-7-14(8-6-12)20-11-13-4-3-9-19-16(13)10-17/h3-9,15H,2,11,18H2,1H3/t15-/m0/s1 |
| InChIKey | KAFCVDJCHXVFIV-HNNXBMFYSA-N |
| XLogP | 2.94 |
| TPSA | 71.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |