C16H26FN3 — CID 63368625
(1R)-1-[2-[4-[(dimethylamino)methyl]piperidin-1-yl]-6-fluorophenyl]ethanamine (PubChem CID 63368625) has the molecular formula C16H26FN3 and a molecular weight of 279.40 g/mol. Its IUPAC name is (1R)-1-[2-[4-[(dimethylamino)methyl]piperidin-1-yl]-6-fluorophenyl]ethanamine.
| Compound Name | (1R)-1-[2-[4-[(dimethylamino)methyl]piperidin-1-yl]-6-fluorophenyl]ethanamine |
|---|---|
| PubChem CID | 63368625 |
| Molecular Formula | C16H26FN3 |
| Molecular Weight | 279.40 g/mol |
| Exact Mass | 279.21 |
| IUPAC Name | (1R)-1-[2-[4-[(dimethylamino)methyl]piperidin-1-yl]-6-fluorophenyl]ethanamine |
| SMILES | C[C@@H](N)c1c(F)cccc1N1CCC(CN(C)C)CC1 |
| InChI | InChI=1S/C16H26FN3/c1-12(18)16-14(17)5-4-6-15(16)20-9-7-13(8-10-20)11-19(2)3/h4-6,12-13H,7-11,18H2,1-3H3/t12-/m1/s1 |
| InChIKey | RZUCKWPSHSULIJ-GFCCVEGCSA-N |
| XLogP | 2.62 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.40 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |