C14H19ClN4 — CID 63369043
4-[(1S)-1-aminoethyl]-2-chloro-N-methyl-N-[(1-methylimidazol-2-yl)methyl]aniline (PubChem CID 63369043) has the molecular formula C14H19ClN4 and a molecular weight of 278.79 g/mol. Its IUPAC name is 4-[(1S)-1-aminoethyl]-2-chloro-N-methyl-N-[(1-methylimidazol-2-yl)methyl]aniline.
| Compound Name | 4-[(1S)-1-aminoethyl]-2-chloro-N-methyl-N-[(1-methylimidazol-2-yl)methyl]aniline |
|---|---|
| PubChem CID | 63369043 |
| Molecular Formula | C14H19ClN4 |
| Molecular Weight | 278.79 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 4-[(1S)-1-aminoethyl]-2-chloro-N-methyl-N-[(1-methylimidazol-2-yl)methyl]aniline |
| SMILES | C[C@H](N)c1ccc(N(C)Cc2nccn2C)c(Cl)c1 |
| InChI | InChI=1S/C14H19ClN4/c1-10(16)11-4-5-13(12(15)8-11)19(3)9-14-17-6-7-18(14)2/h4-8,10H,9,16H2,1-3H3/t10-/m0/s1 |
| InChIKey | FJHWWEOYUKYFFT-JTQLQIEISA-N |
| XLogP | 2.73 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.79 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |