About (1S)-1-[2-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)-6-fluorophenyl]ethanamine
(1S)-1-[2-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)-6-fluorophenyl]ethanamine (PubChem CID 63369049) has the molecular formula C17H19FN2O
and a molecular weight of 286.35 g/mol. Its IUPAC name is (1S)-1-[2-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)-6-fluorophenyl]ethanamine.
Molecular Properties
| Compound Name | (1S)-1-[2-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)-6-fluorophenyl]ethanamine |
| PubChem CID | 63369049 |
| Molecular Formula | C17H19FN2O |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | (1S)-1-[2-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)-6-fluorophenyl]ethanamine |
| SMILES | C[C@H](N)c1c(F)cccc1N1CCOc2ccccc2C1 |
| InChI | InChI=1S/C17H19FN2O/c1-12(19)17-14(18)6-4-7-15(17)20-9-10-21-16-8-3-2-5-13(16)11-20/h2-8,12H,9-11,19H2,1H3/t12-/m0/s1 |
| InChIKey | BKGWMNBXWMKQSQ-LBPRGKRZSA-N |
| XLogP | 3.24 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1S)-1-[2-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)-6-fluorophenyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-[2-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)-6-fluorophenyl]ethanamine?
The IUPAC name of (1S)-1-[2-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)-6-fluorophenyl]ethanamine (CID 63369049) is (1S)-1-[2-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)-6-fluorophenyl]ethanamine.
What is the SMILES notation for (1S)-1-[2-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)-6-fluorophenyl]ethanamine?
The canonical SMILES for (1S)-1-[2-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)-6-fluorophenyl]ethanamine is C[C@H](N)c1c(F)cccc1N1CCOc2ccccc2C1.
What is the InChIKey of (1S)-1-[2-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)-6-fluorophenyl]ethanamine?
The InChIKey is BKGWMNBXWMKQSQ-LBPRGKRZSA-N. The full InChI is InChI=1S/C17H19FN2O/c1-12(19)17-14(18)6-4-7-15(17)20-9-10-21-16-8-3-2-5-13(16)11-20/h2-8,12H,9-11,19H2,1H3/t12-/m0/s1.
What are the key properties of (1S)-1-[2-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)-6-fluorophenyl]ethanamine?
(1S)-1-[2-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)-6-fluorophenyl]ethanamine has a molecular weight of 286.35 g/mol, XLogP of 3.24, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-[2-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)-6-fluorophenyl]ethanamine is sourced from PubChem (CID 63369049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).