About 3-(ethylamino)-6-(3-methylpyrazol-1-yl)-1,3-dihydroindol-2-one
3-(ethylamino)-6-(3-methylpyrazol-1-yl)-1,3-dihydroindol-2-one (PubChem CID 63369234) has the molecular formula C14H16N4O
and a molecular weight of 256.31 g/mol. Its IUPAC name is 3-(ethylamino)-6-(3-methylpyrazol-1-yl)-1,3-dihydroindol-2-one.
Molecular Properties
| Compound Name | 3-(ethylamino)-6-(3-methylpyrazol-1-yl)-1,3-dihydroindol-2-one |
| PubChem CID | 63369234 |
| Molecular Formula | C14H16N4O |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | 3-(ethylamino)-6-(3-methylpyrazol-1-yl)-1,3-dihydroindol-2-one |
| SMILES | CCNC1C(=O)Nc2cc(-n3ccc(C)n3)ccc21 |
| InChI | InChI=1S/C14H16N4O/c1-3-15-13-11-5-4-10(8-12(11)16-14(13)19)18-7-6-9(2)17-18/h4-8,13,15H,3H2,1-2H3,(H,16,19) |
| InChIKey | FFKGVZHNPBFAID-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(ethylamino)-6-(3-methylpyrazol-1-yl)-1,3-dihydroindol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(ethylamino)-6-(3-methylpyrazol-1-yl)-1,3-dihydroindol-2-one?
The IUPAC name of 3-(ethylamino)-6-(3-methylpyrazol-1-yl)-1,3-dihydroindol-2-one (CID 63369234) is 3-(ethylamino)-6-(3-methylpyrazol-1-yl)-1,3-dihydroindol-2-one.
What is the SMILES notation for 3-(ethylamino)-6-(3-methylpyrazol-1-yl)-1,3-dihydroindol-2-one?
The canonical SMILES for 3-(ethylamino)-6-(3-methylpyrazol-1-yl)-1,3-dihydroindol-2-one is CCNC1C(=O)Nc2cc(-n3ccc(C)n3)ccc21.
What is the InChIKey of 3-(ethylamino)-6-(3-methylpyrazol-1-yl)-1,3-dihydroindol-2-one?
The InChIKey is FFKGVZHNPBFAID-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N4O/c1-3-15-13-11-5-4-10(8-12(11)16-14(13)19)18-7-6-9(2)17-18/h4-8,13,15H,3H2,1-2H3,(H,16,19).
What are the key properties of 3-(ethylamino)-6-(3-methylpyrazol-1-yl)-1,3-dihydroindol-2-one?
3-(ethylamino)-6-(3-methylpyrazol-1-yl)-1,3-dihydroindol-2-one has a molecular weight of 256.31 g/mol, XLogP of 1.78, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(ethylamino)-6-(3-methylpyrazol-1-yl)-1,3-dihydroindol-2-one is sourced from PubChem (CID 63369234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).