C13H15F3N2O2 — CID 63370367
3-(propylamino)-6-(2,2,2-trifluoroethoxy)-1,3-dihydroindol-2-one (PubChem CID 63370367) has the molecular formula C13H15F3N2O2 and a molecular weight of 288.27 g/mol. Its IUPAC name is 3-(propylamino)-6-(2,2,2-trifluoroethoxy)-1,3-dihydroindol-2-one.
| Compound Name | 3-(propylamino)-6-(2,2,2-trifluoroethoxy)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 63370367 |
| Molecular Formula | C13H15F3N2O2 |
| Molecular Weight | 288.27 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 3-(propylamino)-6-(2,2,2-trifluoroethoxy)-1,3-dihydroindol-2-one |
| SMILES | CCCNC1C(=O)Nc2cc(OCC(F)(F)F)ccc21 |
| InChI | InChI=1S/C13H15F3N2O2/c1-2-5-17-11-9-4-3-8(20-7-13(14,15)16)6-10(9)18-12(11)19/h3-4,6,11,17H,2,5,7H2,1H3,(H,18,19) |
| InChIKey | FGCHLIAURRMWOO-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.27 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |