C21H10Cl2F3NO — CID 633722
[2,4-dichloro-6-(trifluoromethyl)phenanthren-9-yl]-pyridin-2-ylmethanone (PubChem CID 633722) has the molecular formula C21H10Cl2F3NO and a molecular weight of 420.22 g/mol. Its IUPAC name is [2,4-dichloro-6-(trifluoromethyl)phenanthren-9-yl]-pyridin-2-ylmethanone.
| Compound Name | [2,4-dichloro-6-(trifluoromethyl)phenanthren-9-yl]-pyridin-2-ylmethanone |
|---|---|
| PubChem CID | 633722 |
| Molecular Formula | C21H10Cl2F3NO |
| Molecular Weight | 420.22 g/mol |
| Exact Mass | 419.01 |
| IUPAC Name | [2,4-dichloro-6-(trifluoromethyl)phenanthren-9-yl]-pyridin-2-ylmethanone |
| SMILES | O=C(c1ccccn1)c1cc2cc(Cl)cc(Cl)c2c2cc(C(F)(F)F)ccc12 |
| InChI | InChI=1S/C21H10Cl2F3NO/c22-13-7-11-8-16(20(28)18-3-1-2-6-27-18)14-5-4-12(21(24,25)26)9-15(14)19(11)17(23)10-13/h1-10H |
| InChIKey | PLPHRFGBHQEQTB-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.22 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|