C15H21ClN2O2 — CID 63372792
2-[1-[2-chloro-4-[(1R)-1-hydroxyethyl]phenyl]piperidin-4-yl]acetamide (PubChem CID 63372792) has the molecular formula C15H21ClN2O2 and a molecular weight of 296.80 g/mol. Its IUPAC name is 2-[1-[2-chloro-4-[(1R)-1-hydroxyethyl]phenyl]piperidin-4-yl]acetamide.
| Compound Name | 2-[1-[2-chloro-4-[(1R)-1-hydroxyethyl]phenyl]piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 63372792 |
| Molecular Formula | C15H21ClN2O2 |
| Molecular Weight | 296.80 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 2-[1-[2-chloro-4-[(1R)-1-hydroxyethyl]phenyl]piperidin-4-yl]acetamide |
| SMILES | C[C@@H](O)c1ccc(N2CCC(CC(N)=O)CC2)c(Cl)c1 |
| InChI | InChI=1S/C15H21ClN2O2/c1-10(19)12-2-3-14(13(16)9-12)18-6-4-11(5-7-18)8-15(17)20/h2-3,9-11,19H,4-8H2,1H3,(H2,17,20)/t10-/m1/s1 |
| InChIKey | WRCJVUWMLKQXCV-SNVBAGLBSA-N |
| XLogP | 2.49 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.80 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|