C13H14FN3O — CID 63373269
3-fluoro-4-[(2-methyl-3-oxopiperazin-1-yl)methyl]benzonitrile (PubChem CID 63373269) has the molecular formula C13H14FN3O and a molecular weight of 247.27 g/mol. Its IUPAC name is 3-fluoro-4-[(2-methyl-3-oxopiperazin-1-yl)methyl]benzonitrile.
| Compound Name | 3-fluoro-4-[(2-methyl-3-oxopiperazin-1-yl)methyl]benzonitrile |
|---|---|
| PubChem CID | 63373269 |
| Molecular Formula | C13H14FN3O |
| Molecular Weight | 247.27 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | 3-fluoro-4-[(2-methyl-3-oxopiperazin-1-yl)methyl]benzonitrile |
| SMILES | CC1C(=O)NCCN1Cc1ccc(C#N)cc1F |
| InChI | InChI=1S/C13H14FN3O/c1-9-13(18)16-4-5-17(9)8-11-3-2-10(7-15)6-12(11)14/h2-3,6,9H,4-5,8H2,1H3,(H,16,18) |
| InChIKey | JUUFEPZYHLOXNO-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.27 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |