About methyl 2-[benzyl-(2,2,2-trifluoroacetyl)amino]acetate
methyl 2-[benzyl-(2,2,2-trifluoroacetyl)amino]acetate (PubChem CID 63374519) has the molecular formula C12H12F3NO3
and a molecular weight of 275.23 g/mol. Its IUPAC name is methyl 2-[benzyl-(2,2,2-trifluoroacetyl)amino]acetate.
Molecular Properties
| Compound Name | methyl 2-[benzyl-(2,2,2-trifluoroacetyl)amino]acetate |
| PubChem CID | 63374519 |
| Molecular Formula | C12H12F3NO3 |
| Molecular Weight | 275.23 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | methyl 2-[benzyl-(2,2,2-trifluoroacetyl)amino]acetate |
| SMILES | COC(=O)CN(Cc1ccccc1)C(=O)C(F)(F)F |
| InChI | InChI=1S/C12H12F3NO3/c1-19-10(17)8-16(11(18)12(13,14)15)7-9-5-3-2-4-6-9/h2-6H,7-8H2,1H3 |
| InChIKey | VLGFIFQEHUGDSH-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.23 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 2-[benzyl-(2,2,2-trifluoroacetyl)amino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[benzyl-(2,2,2-trifluoroacetyl)amino]acetate?
The IUPAC name of methyl 2-[benzyl-(2,2,2-trifluoroacetyl)amino]acetate (CID 63374519) is methyl 2-[benzyl-(2,2,2-trifluoroacetyl)amino]acetate.
What is the SMILES notation for methyl 2-[benzyl-(2,2,2-trifluoroacetyl)amino]acetate?
The canonical SMILES for methyl 2-[benzyl-(2,2,2-trifluoroacetyl)amino]acetate is COC(=O)CN(Cc1ccccc1)C(=O)C(F)(F)F.
What is the InChIKey of methyl 2-[benzyl-(2,2,2-trifluoroacetyl)amino]acetate?
The InChIKey is VLGFIFQEHUGDSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12F3NO3/c1-19-10(17)8-16(11(18)12(13,14)15)7-9-5-3-2-4-6-9/h2-6H,7-8H2,1H3.
What are the key properties of methyl 2-[benzyl-(2,2,2-trifluoroacetyl)amino]acetate?
methyl 2-[benzyl-(2,2,2-trifluoroacetyl)amino]acetate has a molecular weight of 275.23 g/mol, XLogP of 1.75, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[benzyl-(2,2,2-trifluoroacetyl)amino]acetate is sourced from PubChem (CID 63374519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).