C10H7F3N4O — CID 63374599
2,2,2-trifluoro-N-[2-(1,2,4-triazol-1-yl)phenyl]acetamide (PubChem CID 63374599) has the molecular formula C10H7F3N4O and a molecular weight of 256.19 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[2-(1,2,4-triazol-1-yl)phenyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[2-(1,2,4-triazol-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 63374599 |
| Molecular Formula | C10H7F3N4O |
| Molecular Weight | 256.19 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | 2,2,2-trifluoro-N-[2-(1,2,4-triazol-1-yl)phenyl]acetamide |
| SMILES | O=C(Nc1ccccc1-n1cncn1)C(F)(F)F |
| InChI | InChI=1S/C10H7F3N4O/c11-10(12,13)9(18)16-7-3-1-2-4-8(7)17-6-14-5-15-17/h1-6H,(H,16,18) |
| InChIKey | UNJYGLMWACJRDV-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.19 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |