C9H10F3NO3S — CID 63374645
N-(1,1-dioxothiolan-3-yl)-2,2,2-trifluoro-N-prop-2-ynylacetamide (PubChem CID 63374645) has the molecular formula C9H10F3NO3S and a molecular weight of 269.24 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-2,2,2-trifluoro-N-prop-2-ynylacetamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-2,2,2-trifluoro-N-prop-2-ynylacetamide |
|---|---|
| PubChem CID | 63374645 |
| Molecular Formula | C9H10F3NO3S |
| Molecular Weight | 269.24 g/mol |
| Exact Mass | 269.03 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-2,2,2-trifluoro-N-prop-2-ynylacetamide |
| SMILES | C#CCN(C(=O)C(F)(F)F)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C9H10F3NO3S/c1-2-4-13(8(14)9(10,11)12)7-3-5-17(15,16)6-7/h1,7H,3-6H2 |
| InChIKey | LUHNOJWVDMYGOS-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.24 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|