About 1-Propanamine, 3-(triethoxysilyl)-, reaction products with wollastonite (Ca(SiO3))
1-Propanamine, 3-(triethoxysilyl)-, reaction products with wollastonite (Ca(SiO3)) (PubChem CID 6337496) has the molecular formula C9H25CaNO6Si2
and a molecular weight of 339.55 g/mol.
Molecular Properties
| Compound Name | 1-Propanamine, 3-(triethoxysilyl)-, reaction products with wollastonite (Ca(SiO3)) |
| PubChem CID | 6337496 |
| Molecular Formula | C9H25CaNO6Si2 |
| Molecular Weight | 339.55 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | — |
| SMILES | CCO[Si](CCCN)(OCC)OCC.O=[Si](O)O.[Ca] |
| InChI | InChI=1S/C9H23NO3Si.Ca.H2O3Si/c1-4-11-14(12-5-2,13-6-3)9-7-8-10;;1-4(2)3/h4-10H2,1-3H3;;1-2H |
| InChIKey | ZQPMOFPDNIELTM-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.55 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-Propanamine, 3-(triethoxysilyl)-, reaction products with wollastonite (Ca(SiO3)) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-Propanamine, 3-(triethoxysilyl)-, reaction products with wollastonite (Ca(SiO3))?
The IUPAC name of 1-Propanamine, 3-(triethoxysilyl)-, reaction products with wollastonite (Ca(SiO3)) (CID 6337496) is not available.
What is the SMILES notation for 1-Propanamine, 3-(triethoxysilyl)-, reaction products with wollastonite (Ca(SiO3))?
The canonical SMILES for 1-Propanamine, 3-(triethoxysilyl)-, reaction products with wollastonite (Ca(SiO3)) is CCO[Si](CCCN)(OCC)OCC.O=[Si](O)O.[Ca].
What is the InChIKey of 1-Propanamine, 3-(triethoxysilyl)-, reaction products with wollastonite (Ca(SiO3))?
The InChIKey is ZQPMOFPDNIELTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H23NO3Si.Ca.H2O3Si/c1-4-11-14(12-5-2,13-6-3)9-7-8-10;;1-4(2)3/h4-10H2,1-3H3;;1-2H.
What are the key properties of 1-Propanamine, 3-(triethoxysilyl)-, reaction products with wollastonite (Ca(SiO3))?
1-Propanamine, 3-(triethoxysilyl)-, reaction products with wollastonite (Ca(SiO3)) has a molecular weight of 339.55 g/mol, XLogP of -0.61, 9 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-Propanamine, 3-(triethoxysilyl)-, reaction products with wollastonite (Ca(SiO3)) is sourced from PubChem (CID 6337496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).