About 4-chloro-5,7-difluoroquinoline-2-carboxylic acid
4-chloro-5,7-difluoroquinoline-2-carboxylic acid (PubChem CID 63375740) has the molecular formula C10H4ClF2NO2
and a molecular weight of 243.60 g/mol. Its IUPAC name is 4-chloro-5,7-difluoroquinoline-2-carboxylic acid.
Molecular Properties
| Compound Name | 4-chloro-5,7-difluoroquinoline-2-carboxylic acid |
| PubChem CID | 63375740 |
| Molecular Formula | C10H4ClF2NO2 |
| Molecular Weight | 243.60 g/mol |
| Exact Mass | 242.99 |
| IUPAC Name | 4-chloro-5,7-difluoroquinoline-2-carboxylic acid |
| SMILES | O=C(O)c1cc(Cl)c2c(F)cc(F)cc2n1 |
| InChI | InChI=1S/C10H4ClF2NO2/c11-5-3-8(10(15)16)14-7-2-4(12)1-6(13)9(5)7/h1-3H,(H,15,16) |
| InChIKey | GMZBYAKUAYCTDP-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.60 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-chloro-5,7-difluoroquinoline-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-5,7-difluoroquinoline-2-carboxylic acid?
The IUPAC name of 4-chloro-5,7-difluoroquinoline-2-carboxylic acid (CID 63375740) is 4-chloro-5,7-difluoroquinoline-2-carboxylic acid.
What is the SMILES notation for 4-chloro-5,7-difluoroquinoline-2-carboxylic acid?
The canonical SMILES for 4-chloro-5,7-difluoroquinoline-2-carboxylic acid is O=C(O)c1cc(Cl)c2c(F)cc(F)cc2n1.
What is the InChIKey of 4-chloro-5,7-difluoroquinoline-2-carboxylic acid?
The InChIKey is GMZBYAKUAYCTDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H4ClF2NO2/c11-5-3-8(10(15)16)14-7-2-4(12)1-6(13)9(5)7/h1-3H,(H,15,16).
What are the key properties of 4-chloro-5,7-difluoroquinoline-2-carboxylic acid?
4-chloro-5,7-difluoroquinoline-2-carboxylic acid has a molecular weight of 243.60 g/mol, XLogP of 2.86, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-5,7-difluoroquinoline-2-carboxylic acid is sourced from PubChem (CID 63375740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).