About 4-Chlorophenyl)diphenyltin hydrate
4-Chlorophenyl)diphenyltin hydrate (PubChem CID 6337670) has the molecular formula C18H16ClOSn
and a molecular weight of 402.49 g/mol.
Molecular Properties
| Compound Name | 4-Chlorophenyl)diphenyltin hydrate |
| PubChem CID | 6337670 |
| Molecular Formula | C18H16ClOSn |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.99 |
| IUPAC Name | — |
| SMILES | Clc1ccc([Sn](c2ccccc2)c2ccccc2)cc1.O |
| InChI | InChI=1S/C6H4Cl.2C6H5.H2O.Sn/c7-6-4-2-1-3-5-6;2*1-2-4-6-5-3-1;;/h2-5H;2*1-5H;1H2; |
| InChIKey | YMVGKWPEHQVCHK-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 31.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 4-Chlorophenyl)diphenyltin hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-Chlorophenyl)diphenyltin hydrate?
The IUPAC name of 4-Chlorophenyl)diphenyltin hydrate (CID 6337670) is not available.
What is the SMILES notation for 4-Chlorophenyl)diphenyltin hydrate?
The canonical SMILES for 4-Chlorophenyl)diphenyltin hydrate is Clc1ccc([Sn](c2ccccc2)c2ccccc2)cc1.O.
What is the InChIKey of 4-Chlorophenyl)diphenyltin hydrate?
The InChIKey is YMVGKWPEHQVCHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4Cl.2C6H5.H2O.Sn/c7-6-4-2-1-3-5-6;2*1-2-4-6-5-3-1;;/h2-5H;2*1-5H;1H2;.
What are the key properties of 4-Chlorophenyl)diphenyltin hydrate?
4-Chlorophenyl)diphenyltin hydrate has a molecular weight of 402.49 g/mol, XLogP of 2.03, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-Chlorophenyl)diphenyltin hydrate is sourced from PubChem (CID 6337670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).