C12H6Cl3NO3 — CID 63376747
6-chloro-2-(3,5-dichlorophenoxy)pyridine-3-carboxylic acid (PubChem CID 63376747) has the molecular formula C12H6Cl3NO3 and a molecular weight of 318.54 g/mol. Its IUPAC name is 6-chloro-2-(3,5-dichlorophenoxy)pyridine-3-carboxylic acid.
| Compound Name | 6-chloro-2-(3,5-dichlorophenoxy)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 63376747 |
| Molecular Formula | C12H6Cl3NO3 |
| Molecular Weight | 318.54 g/mol |
| Exact Mass | 316.94 |
| IUPAC Name | 6-chloro-2-(3,5-dichlorophenoxy)pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1ccc(Cl)nc1Oc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C12H6Cl3NO3/c13-6-3-7(14)5-8(4-6)19-11-9(12(17)18)1-2-10(15)16-11/h1-5H,(H,17,18) |
| InChIKey | OBOCLFFUIGMYDD-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.54 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|