5,8-dibromo-4-chloroquinoline-2-carboxylic acid

C10H4Br2ClNO2 — CID 63376797

IUPAC5,8-dibromo-4-chloroquinoline-2-carboxylic acid
SMILESO=C(O)c1cc(Cl)c2c(Br)ccc(Br)c2n1
InChIInChI=1S/C10H4Br2ClNO2/c11-4-1-2-5(12)9-8(4)6(13)3-7(14-9)10(15)16/h1-3H,(H,15,16)
InChIKeyMHVHXNWZARHULV-UHFFFAOYSA-N
MW365.41 g/mol
LogP4.11
Rot. Bonds1

About 5,8-dibromo-4-chloroquinoline-2-carboxylic acid

5,8-dibromo-4-chloroquinoline-2-carboxylic acid (PubChem CID 63376797) has the molecular formula C10H4Br2ClNO2 and a molecular weight of 365.41 g/mol. Its IUPAC name is 5,8-dibromo-4-chloroquinoline-2-carboxylic acid.

Molecular Properties

Compound Name5,8-dibromo-4-chloroquinoline-2-carboxylic acid
PubChem CID63376797
Molecular FormulaC10H4Br2ClNO2
Molecular Weight365.41 g/mol
Exact Mass362.83
IUPAC Name5,8-dibromo-4-chloroquinoline-2-carboxylic acid
SMILESO=C(O)c1cc(Cl)c2c(Br)ccc(Br)c2n1
InChIInChI=1S/C10H4Br2ClNO2/c11-4-1-2-5(12)9-8(4)6(13)3-7(14-9)10(15)16/h1-3H,(H,15,16)
InChIKeyMHVHXNWZARHULV-UHFFFAOYSA-N
XLogP4.11
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500365.41
LogP ≤ 54.11
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 5,8-dibromo-4-chloroquinoline-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5,8-dibromo-4-chloroquinoline-2-carboxylic acid?
The IUPAC name of 5,8-dibromo-4-chloroquinoline-2-carboxylic acid (CID 63376797) is 5,8-dibromo-4-chloroquinoline-2-carboxylic acid.
What is the SMILES notation for 5,8-dibromo-4-chloroquinoline-2-carboxylic acid?
The canonical SMILES for 5,8-dibromo-4-chloroquinoline-2-carboxylic acid is O=C(O)c1cc(Cl)c2c(Br)ccc(Br)c2n1.
What is the InChIKey of 5,8-dibromo-4-chloroquinoline-2-carboxylic acid?
The InChIKey is MHVHXNWZARHULV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H4Br2ClNO2/c11-4-1-2-5(12)9-8(4)6(13)3-7(14-9)10(15)16/h1-3H,(H,15,16).
What are the key properties of 5,8-dibromo-4-chloroquinoline-2-carboxylic acid?
5,8-dibromo-4-chloroquinoline-2-carboxylic acid has a molecular weight of 365.41 g/mol, XLogP of 4.11, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,8-dibromo-4-chloroquinoline-2-carboxylic acid is sourced from PubChem (CID 63376797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).