C18H18N2O — CID 63377413
[4-(2,3-dimethylphenoxy)quinolin-2-yl]methanamine (PubChem CID 63377413) has the molecular formula C18H18N2O and a molecular weight of 278.35 g/mol. Its IUPAC name is [4-(2,3-dimethylphenoxy)quinolin-2-yl]methanamine.
| Compound Name | [4-(2,3-dimethylphenoxy)quinolin-2-yl]methanamine |
|---|---|
| PubChem CID | 63377413 |
| Molecular Formula | C18H18N2O |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | [4-(2,3-dimethylphenoxy)quinolin-2-yl]methanamine |
| SMILES | Cc1cccc(Oc2cc(CN)nc3ccccc23)c1C |
| InChI | InChI=1S/C18H18N2O/c1-12-6-5-9-17(13(12)2)21-18-10-14(11-19)20-16-8-4-3-7-15(16)18/h3-10H,11,19H2,1-2H3 |
| InChIKey | JIHBSFFFVDEPRU-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |