C15H16ClNO2S — CID 63377850
5-[[1-(4-chlorophenyl)ethyl-methylamino]methyl]thiophene-2-carboxylic acid (PubChem CID 63377850) has the molecular formula C15H16ClNO2S and a molecular weight of 309.82 g/mol. Its IUPAC name is 5-[[1-(4-chlorophenyl)ethyl-methylamino]methyl]thiophene-2-carboxylic acid.
| Compound Name | 5-[[1-(4-chlorophenyl)ethyl-methylamino]methyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 63377850 |
| Molecular Formula | C15H16ClNO2S |
| Molecular Weight | 309.82 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | 5-[[1-(4-chlorophenyl)ethyl-methylamino]methyl]thiophene-2-carboxylic acid |
| SMILES | CC(c1ccc(Cl)cc1)N(C)Cc1ccc(C(=O)O)s1 |
| InChI | InChI=1S/C15H16ClNO2S/c1-10(11-3-5-12(16)6-4-11)17(2)9-13-7-8-14(20-13)15(18)19/h3-8,10H,9H2,1-2H3,(H,18,19) |
| InChIKey | WDROBHULQJEOAJ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.82 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |