About 5-[(N,3,5-trimethylanilino)methyl]thiophene-2-carboxylic acid
5-[(N,3,5-trimethylanilino)methyl]thiophene-2-carboxylic acid (PubChem CID 63378033) has the molecular formula C15H17NO2S
and a molecular weight of 275.37 g/mol. Its IUPAC name is 5-[(N,3,5-trimethylanilino)methyl]thiophene-2-carboxylic acid.
Molecular Properties
| Compound Name | 5-[(N,3,5-trimethylanilino)methyl]thiophene-2-carboxylic acid |
| PubChem CID | 63378033 |
| Molecular Formula | C15H17NO2S |
| Molecular Weight | 275.37 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | 5-[(N,3,5-trimethylanilino)methyl]thiophene-2-carboxylic acid |
| SMILES | Cc1cc(C)cc(N(C)Cc2ccc(C(=O)O)s2)c1 |
| InChI | InChI=1S/C15H17NO2S/c1-10-6-11(2)8-12(7-10)16(3)9-13-4-5-14(19-13)15(17)18/h4-8H,9H2,1-3H3,(H,17,18) |
| InChIKey | VJOUFTFKVZUEDC-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.37 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[(N,3,5-trimethylanilino)methyl]thiophene-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(N,3,5-trimethylanilino)methyl]thiophene-2-carboxylic acid?
The IUPAC name of 5-[(N,3,5-trimethylanilino)methyl]thiophene-2-carboxylic acid (CID 63378033) is 5-[(N,3,5-trimethylanilino)methyl]thiophene-2-carboxylic acid.
What is the SMILES notation for 5-[(N,3,5-trimethylanilino)methyl]thiophene-2-carboxylic acid?
The canonical SMILES for 5-[(N,3,5-trimethylanilino)methyl]thiophene-2-carboxylic acid is Cc1cc(C)cc(N(C)Cc2ccc(C(=O)O)s2)c1.
What is the InChIKey of 5-[(N,3,5-trimethylanilino)methyl]thiophene-2-carboxylic acid?
The InChIKey is VJOUFTFKVZUEDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17NO2S/c1-10-6-11(2)8-12(7-10)16(3)9-13-4-5-14(19-13)15(17)18/h4-8H,9H2,1-3H3,(H,17,18).
What are the key properties of 5-[(N,3,5-trimethylanilino)methyl]thiophene-2-carboxylic acid?
5-[(N,3,5-trimethylanilino)methyl]thiophene-2-carboxylic acid has a molecular weight of 275.37 g/mol, XLogP of 3.70, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(N,3,5-trimethylanilino)methyl]thiophene-2-carboxylic acid is sourced from PubChem (CID 63378033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).