About 4-[[1-(1,3-dimethylpyrazol-4-yl)ethylamino]methyl]-N-methylbenzamide
4-[[1-(1,3-dimethylpyrazol-4-yl)ethylamino]methyl]-N-methylbenzamide (PubChem CID 63378518) has the molecular formula C16H22N4O
and a molecular weight of 286.38 g/mol. Its IUPAC name is 4-[[1-(1,3-dimethylpyrazol-4-yl)ethylamino]methyl]-N-methylbenzamide.
Molecular Properties
| Compound Name | 4-[[1-(1,3-dimethylpyrazol-4-yl)ethylamino]methyl]-N-methylbenzamide |
| PubChem CID | 63378518 |
| Molecular Formula | C16H22N4O |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | 4-[[1-(1,3-dimethylpyrazol-4-yl)ethylamino]methyl]-N-methylbenzamide |
| SMILES | CNC(=O)c1ccc(CNC(C)c2cn(C)nc2C)cc1 |
| InChI | InChI=1S/C16H22N4O/c1-11(15-10-20(4)19-12(15)2)18-9-13-5-7-14(8-6-13)16(21)17-3/h5-8,10-11,18H,9H2,1-4H3,(H,17,21) |
| InChIKey | GNSYAVRBKRUGKY-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[[1-(1,3-dimethylpyrazol-4-yl)ethylamino]methyl]-N-methylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[1-(1,3-dimethylpyrazol-4-yl)ethylamino]methyl]-N-methylbenzamide?
The IUPAC name of 4-[[1-(1,3-dimethylpyrazol-4-yl)ethylamino]methyl]-N-methylbenzamide (CID 63378518) is 4-[[1-(1,3-dimethylpyrazol-4-yl)ethylamino]methyl]-N-methylbenzamide.
What is the SMILES notation for 4-[[1-(1,3-dimethylpyrazol-4-yl)ethylamino]methyl]-N-methylbenzamide?
The canonical SMILES for 4-[[1-(1,3-dimethylpyrazol-4-yl)ethylamino]methyl]-N-methylbenzamide is CNC(=O)c1ccc(CNC(C)c2cn(C)nc2C)cc1.
What is the InChIKey of 4-[[1-(1,3-dimethylpyrazol-4-yl)ethylamino]methyl]-N-methylbenzamide?
The InChIKey is GNSYAVRBKRUGKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22N4O/c1-11(15-10-20(4)19-12(15)2)18-9-13-5-7-14(8-6-13)16(21)17-3/h5-8,10-11,18H,9H2,1-4H3,(H,17,21).
What are the key properties of 4-[[1-(1,3-dimethylpyrazol-4-yl)ethylamino]methyl]-N-methylbenzamide?
4-[[1-(1,3-dimethylpyrazol-4-yl)ethylamino]methyl]-N-methylbenzamide has a molecular weight of 286.38 g/mol, XLogP of 1.94, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[1-(1,3-dimethylpyrazol-4-yl)ethylamino]methyl]-N-methylbenzamide is sourced from PubChem (CID 63378518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).