C17H7ClF6O2 — CID 633788
6-chloro-2,4-bis(trifluoromethyl)phenanthrene-9-carboxylic acid (PubChem CID 633788) has the molecular formula C17H7ClF6O2 and a molecular weight of 392.68 g/mol. Its IUPAC name is 6-chloro-2,4-bis(trifluoromethyl)phenanthrene-9-carboxylic acid.
| Compound Name | 6-chloro-2,4-bis(trifluoromethyl)phenanthrene-9-carboxylic acid |
|---|---|
| PubChem CID | 633788 |
| Molecular Formula | C17H7ClF6O2 |
| Molecular Weight | 392.68 g/mol |
| Exact Mass | 392.00 |
| IUPAC Name | 6-chloro-2,4-bis(trifluoromethyl)phenanthrene-9-carboxylic acid |
| SMILES | O=C(O)c1cc2cc(C(F)(F)F)cc(C(F)(F)F)c2c2cc(Cl)ccc12 |
| InChI | InChI=1S/C17H7ClF6O2/c18-9-1-2-10-11(6-9)14-7(4-12(10)15(25)26)3-8(16(19,20)21)5-13(14)17(22,23)24/h1-6H,(H,25,26) |
| InChIKey | XFSRFVHDJRULAQ-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.68 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|