About 1-(6,7-dihydro-4H-thiopyrano[4,3-d][1,3]thiazol-2-yl)ethanone
1-(6,7-dihydro-4H-thiopyrano[4,3-d][1,3]thiazol-2-yl)ethanone (PubChem CID 63379224) has the molecular formula C8H9NOS2
and a molecular weight of 199.30 g/mol. Its IUPAC name is 1-(6,7-dihydro-4H-thiopyrano[4,3-d][1,3]thiazol-2-yl)ethanone.
Molecular Properties
| Compound Name | 1-(6,7-dihydro-4H-thiopyrano[4,3-d][1,3]thiazol-2-yl)ethanone |
| PubChem CID | 63379224 |
| Molecular Formula | C8H9NOS2 |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.01 |
| IUPAC Name | 1-(6,7-dihydro-4H-thiopyrano[4,3-d][1,3]thiazol-2-yl)ethanone |
| SMILES | CC(=O)c1nc2c(s1)CSCC2 |
| InChI | InChI=1S/C8H9NOS2/c1-5(10)8-9-6-2-3-11-4-7(6)12-8/h2-4H2,1H3 |
| InChIKey | VALCRWGNONGTNH-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(6,7-dihydro-4H-thiopyrano[4,3-d][1,3]thiazol-2-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6,7-dihydro-4H-thiopyrano[4,3-d][1,3]thiazol-2-yl)ethanone?
The IUPAC name of 1-(6,7-dihydro-4H-thiopyrano[4,3-d][1,3]thiazol-2-yl)ethanone (CID 63379224) is 1-(6,7-dihydro-4H-thiopyrano[4,3-d][1,3]thiazol-2-yl)ethanone.
What is the SMILES notation for 1-(6,7-dihydro-4H-thiopyrano[4,3-d][1,3]thiazol-2-yl)ethanone?
The canonical SMILES for 1-(6,7-dihydro-4H-thiopyrano[4,3-d][1,3]thiazol-2-yl)ethanone is CC(=O)c1nc2c(s1)CSCC2.
What is the InChIKey of 1-(6,7-dihydro-4H-thiopyrano[4,3-d][1,3]thiazol-2-yl)ethanone?
The InChIKey is VALCRWGNONGTNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NOS2/c1-5(10)8-9-6-2-3-11-4-7(6)12-8/h2-4H2,1H3.
What are the key properties of 1-(6,7-dihydro-4H-thiopyrano[4,3-d][1,3]thiazol-2-yl)ethanone?
1-(6,7-dihydro-4H-thiopyrano[4,3-d][1,3]thiazol-2-yl)ethanone has a molecular weight of 199.30 g/mol, XLogP of 2.13, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6,7-dihydro-4H-thiopyrano[4,3-d][1,3]thiazol-2-yl)ethanone is sourced from PubChem (CID 63379224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).